Boc-A(Z)-Aeg-OH
| Product Name | Boc-A(Z)-Aeg-OH |
| Structure | ![]() |
| CAT.NO | BM-002 |
| CAS Number | 149376-69-2 |
| Formula | C24H29N7O7 |
| Formula Weight | 527.53 |
| Application | For PNA synthesis |
| Description | PNA monomer incorporating a A nucleobase analogue through the Boc protecting group |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Purity | >98.5% |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| Size | 1 g/5 g/10 g/25 g |
| InChI | InChI=1S/C24H29N7O7/c1-24(2,3)38-22(35)25-9-10-30(12-18(33)34)17(32)11-31-15-28-19-20(26-14-27-21(19)31)29-23(36)37-13-16-7-5-4-6-8-16/h4-8,14-15H,9-13H2,1-3H3,(H,25,35)(H,33,34)(H,26,27,29,36) |
| InChI Key | HNSNKXSLRGSKQN-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)OC(=O)NCCN(CC(=O)O)C(=O)CN1C=NC2=C(N=CN=C21)NC(=O)OCC3=CC=CC=C3 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl-[2-[6-(phenylmethoxycarbonylamino)purin-9-yl]acetyl]amino]acetic acid |
-Aeg-OH.png)