Boc-G(Z)-Aeg-OH
| Product Name | Boc-G(Z)-Aeg-OH |
| Structure | -Aeg-OH.png) |
| CAT.NO | BM-005 |
| CAS Number | 169287-77-8 |
| Formula | C24H29N7O8 |
| Formula Weight | 543.53 |
| Application | For PNA synthesis |
| Description | PNA monomer incorporating a G nucleobase analogue through the Boc protecting group |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Purity | >98.5% |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| Size | 1 g/5 g/10 g/25 g |
| InChI | InChI=1S/C24H29N7O8/c1-24(2,3)39-22(36)25-9-10-30(12-17(33)34)16(32)11-31-14-26-18-19(31)27-21(28-20(18)35)29-23(37)38-13-15-7-5-4-6-8-15/h4-8,14H,9-13H2,1-3H3,(H,25,36)(H,33,34)(H2,27,28,29,35,37) |
| InChI Key | QPFRXGPXBKQVPU-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)OC(=O)NCCN(CC(=O)O)C(=O)CN1C=NC2=C1N=C(NC2=O)NC(=O)OCC3=CC=CC=C3 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl-[2-[6-oxo-2-(phenylmethoxycarbonylamino)-1H-purin-9-yl]acetyl]amino]acetic acid |
