Boc-PNA-C(Z)-OH
| Product Name | Boc-PNA-C(Z)-OH |
| Structure | -OH.png) |
| CAT.NO | BM-001 |
| CAS Number | 144564-94-3 |
| Other Name | Boc-C(Z)-Aeg-OH |
| Formula | C24H31N5O8 |
| Formula Weight | 503.51 |
| Application | For PNA synthesis |
| Description | PNA monomer incorporating a C nucleobase analogue through the Boc protecting group |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| Size | 1 g/10 g/25 g/>25 g |
| InChI | InChI=1S/C23H29N5O8/c1-23(2,3)36-21(33)24-10-12-27(14-19(30)31)18(29)13-28-11-9-17(25-20(28)32)26-22(34)35-15-16-7-5-4-6-8-16/h4-9,11H,10,12-15H2,1-3H3,(H,24,33)(H,30,31)(H,25,26,32,34) |
| InChI Key | UCPRPVFFEVZHEJ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)OC(=O)NCCN(CC(=O)O)C(=O)CN1C=CC(=NC1=O)NC(=O)OCC2=CC=CC=C2 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl-[2-[2-oxo-4-(phenylmethoxycarbonylamino)pyrimidin-1-yl]acetyl]amino]acetic acid |
