| Product Name | Boc-PNA-thioU(PMB)-OH |
| Structure | -OH.png) |
| CAT.NO | BM-011 |
| CAS Number | 253438-99-2 |
| Other Name | Boc-thioU(PMB)-OH; 2-[[2-[2-[(4-methoxyphenyl)methylsulfanyl]-4-oxopyrimidin-1-yl]acetyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid; MFCD31720339; N-[[[2-[(4-Methoxybenzyl)thio]-4-oxo-1,4-dihydropyrimidine]-1-yl]acetyl]-N-[2-[(tert-butyloxycarbonyl)amino]ethyl]glycine |
| Formula | C23H30N4O7S |
| Formula Weight | 506.57 |
| Application | For PNA synthesis |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| Size | 1 g/10 g/25 g/>25 g |
| InChI | InChI=1S/C23H30N4O7S/c1-23(2,3)34-22(32)24-10-12-26(14-20(30)31)19(29)13-27-11-9-18(28)25-21(27)35-15-16-5-7-17(33-4)8-6-16/h5-9,11H,10,12-15H2,1-4H3,(H,24,32)(H,30,31) |
| InChI Key | HDKCTBBIWSKCEV-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)OC(=O)NCCN(CC(=O)O)C(=O)CN1C=CC(=O)N=C1SCC2=CC=C(C=C2)OC |
| IUPAC Name | 2-[[2-[2-[(4-methoxyphenyl)methylsulfanyl]-4-oxopyrimidin-1-yl]acetyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid |