| Product Name | Boc-T-Aeg-OH |
| Structure |  |
| CAT.NO | BM-007 |
| CAS Number | 139166-80-6 |
| Formula | C16H24N4O8 |
| Formula Weight | 384.38 |
| Application | For PNA synthesis |
| Description | PNA monomer incorporating a T nucleobase analogue through the Boc protecting group |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Purity | >98.5% |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| Size | 1 g/5 g/10 g/25 g |
| InChI | InChI=1S/C16H24N4O7/c1-10-7-20(14(25)18-13(10)24)8-11(21)19(9-12(22)23)6-5-17-15(26)27-16(2,3)4/h7H,5-6,8-9H2,1-4H3,(H,17,26)(H,22,23)(H,18,24,25) |
| InChI Key | WOTJPRVGZZWRGT-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)CC(=O)N(CCNC(=O)OC(C)(C)C)CC(=O)O |
| IUPAC Name | 2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid |
