Fmoc-A(Bhoc)-Aeg-OH
Product Name | Fmoc-A(Bhoc)-Aeg-OH |
Structure | ![]() |
CAT.NO | FM-001 |
CAS Number | 186046-82-2 |
Formula | C40H35N7O7 |
Formula Weight | 725.75 |
Application | For PNA synthesis |
Description | PNA monomer incorporating a A nucleobase analogue through the Fmoc protecting group |
Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
Purity | >98.5% |
Solubility | Fast dissolution |
Purification | By HPLC |
Size | 1 g/2 g/ 5 g/10 g/25 g |
InChI | InChI=1S/C40H35N7O7/c48-33(46(22-34(49)50)20-19-41-39(51)53-23-32-30-17-9-7-15-28(30)29-16-8-10-18-31(29)32)21-47-25-44-35-37(42-24-43-38(35)47)45-40(52)54-36(26-11-3-1-4-12-26)27-13-5-2-6-14-27/h1-18,24-25,32,36H,19-23H2,(H,41,51)(H,49,50)(H,42,43,45,52) |
InChI Key | LVVQRXRVCLWIIO-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)OC(=O)NC3=C4C(=NC=N3)N(C=N4)CC(=O)N(CCNC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57)CC(=O)O |
IUPAC Name | 2-[[2-[6-(benzhydryloxycarbonylamino)purin-9-yl]acetyl]-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]amino]acetic acid |