| Product Name | Fmoc-Aeea-OH |
| CAT.NO | FM-009 |
| CAS Number | 166108-71-0 |
| Formula | C21H23NO6 |
| Formula Weight | 385.4 |
| Application | For PNA synthesis |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Purity | >97% |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| Size | 1 g |
| InChI | InChI=1S/C21H23NO6/c23-20(24)14-27-12-11-26-10-9-22-21(25)28-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,19H,9-14H2,(H,22,25)(H,23,24) |
| InChI Key | XQPYRJIMPDBGRW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCC(=O)O |
| IUPAC Name | 2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetic acid |