Fmoc-C(Bhoc)-Aeg-OH
| Product Name | Fmoc-C(Bhoc)-Aeg-OH |
| Structure | -Aeg-OH.png) |
| CAT.NO | FM-002 |
| CAS Number | 186046-81-1 |
| Formula | C39H35N5O8 |
| Formula Weight | 701.72 |
| Application | For PNA synthesis |
| Description | PNA monomer incorporating a C nucleobase analogue through the Fmoc protecting group |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Purity | >98.5% |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| Size | 1 g/2 g/ 5 g/10 g/25 g |
| InChI | InChI=1S/C39H35N5O8/c45-34(23-44-21-19-33(41-37(44)48)42-39(50)52-36(26-11-3-1-4-12-26)27-13-5-2-6-14-27)43(24-35(46)47)22-20-40-38(49)51-25-32-30-17-9-7-15-28(30)29-16-8-10-18-31(29)32/h1-19,21,32,36H,20,22-25H2,(H,40,49)(H,46,47)(H,41,42,48,50) |
| InChI Key | YPTOIRLDQISSCH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)OC(=O)NC3=NC(=O)N(C=C3)CC(=O)N(CCNC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46)CC(=O)O |
| IUPAC Name | 2-[[2-[4-(benzhydryloxycarbonylamino)-2-oxopyrimidin-1-yl]acetyl]-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]amino]acetic acid |
