Fmoc-G(Bhoc)-Aeg-OH
Product Name | Fmoc-G(Bhoc)-Aeg-OH |
Structure | |
CAT.NO | FM-003 |
CAS Number | 186046-83-3 |
Formula | C40H35N7O8 |
Formula Weight | 741.75 |
Application | For PNA synthesis |
Description | PNA monomer incorporating a G nucleobase analogue through the Fmoc protecting group |
Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
Purity | >98.5% |
Solubility | Fast dissolution |
Purification | By HPLC |
Size | 1 g/2 g/ 5 g/10 g/25 g |
InChI | InChI=1S/C40H35N7O8/c48-32(46(22-33(49)50)20-19-41-39(52)54-23-31-29-17-9-7-15-27(29)28-16-8-10-18-30(28)31)21-47-24-42-34-36(47)43-38(44-37(34)51)45-40(53)55-35(25-11-3-1-4-12-25)26-13-5-2-6-14-26/h1-18,24,31,35H,19-23H2,(H,41,52)(H,49,50)(H2,43,44,45,51,53) |
InChI Key | ZNHVLNAONKUINW-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)OC(=O)NC3=NC4=C(C(=O)N3)N=CN4CC(=O)N(CCNC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57)CC(=O)O |
IUPAC Name | 2-[[2-[2-(benzhydryloxycarbonylamino)-6-oxo-1H-purin-9-yl]acetyl]-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]amino]acetic acid |