Fmoc-PNA-G(Boc)-OH
| Product Name | Fmoc-PNA-G(Boc)-OH |
| Structure | ![]() |
| CAT.NO | FM-014 |
| CAS Number | 1052677-90-3 |
| Other Name | 2-(N-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethyl)-2-(2-((tert-butoxycarbonyl)amino)-6-oxo-1H-purin-9(6H)-yl)acetamido)acetic acid; N-[2-(tert-Butoxycarbonylamino)-6-oxo-1,6-dihydro-9H-purine-9-ylacetyl]-N-[2-(9H-fluorene-9-ylmethoxycarbonylamino)ethyl]glycine |
| Formula | C31H33N7O8 |
| Formula Weight | 631.65 |
| Application | For PNA synthesis |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| Size | 1 g/5 g |
| InChI | InChI=1S/C31H33N7O8/c1-31(2,3)46-30(44)36-28-34-26-25(27(42)35-28)33-17-38(26)14-23(39)37(15-24(40)41)13-12-32-29(43)45-16-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22/h4-11,17,22H,12-16H2,1-3H3,(H,32,43)(H,40,41)(H2,34,35,36,42,44) |
| InChI Key | JVIAXIMEDXKTSN-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)OC(=O)NC1=NC2=C(C(=O)N1)N=CN2CC(=O)N(CCNC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)CC(=O)O |
| IUPAC Name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid |
-OH.png)