| Product Name | Fmoc-PNA-U-OH |
| Structure |  |
| CAT.NO | FM-007 |
| CAS Number | 959151-70-3 |
| Formula | C25H24N4O5 |
| Formula Weight | 355.54 |
| Application | For PNA synthesis |
| Description | PNA monomer incorporating a U nucleobase analogue through the Fmoc protecting group |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Purity | >98.5% |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| InChI | InChI=1S/C25H24N4O7/c30-21-9-11-29(24(34)27-21)13-22(31)28(14-23(32)33)12-10-26-25(35)36-15-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-9,11,20H,10,12-15H2,(H,26,35)(H,32,33)(H,27,30,34) |
| InChI Key | SSDDNBIJABMEDZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCN(CC(=O)O)C(=O)CN4C=CC(=O)NC4=O |
| IUPAC Name | 2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]amino]acetic acid |
