Fmoc-T-Aeg-OH
| Product Name | Fmoc-T-Aeg-OH |
| Structure | ![]() |
| CAT.NO | FM-006 |
| CAS Number | 169396-92-3 |
| Other Name | Fmoc-PNA-T-OH |
| Formula | C26H26N4O7 |
| Formula Weight | 506.51 |
| Application | For PNA synthesis |
| Description | PNA monomer incorporating a T nucleobase analogue through the Fmoc protecting group |
| Specificity | The PNA monomer has mild chemical properties, the protecting group is easy to remove during the synthesis process and can be quickly separated from the resin. |
| Purity | >98.5% |
| Solubility | Fast dissolution |
| Purification | By HPLC |
| Size | 1 g/5 g/10 g/25 g |
| InChI | InChI=1S/C26H26N4O7/c1-16-12-30(25(35)28-24(16)34)13-22(31)29(14-23(32)33)11-10-27-26(36)37-15-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21/h2-9,12,21H,10-11,13-15H2,1H3,(H,27,36)(H,32,33)(H,28,34,35) |
| InChI Key | REUYSHQBEXUIRY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)CC(=O)N(CCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CC(=O)O |
| IUPAC Name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]acetic acid |
